C24H29F2N3O3S — CID 161485850
3-amino-2-[[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]ethylamino]methyl]prop-2-enal (PubChem CID 161485850) has the molecular formula C24H29F2N3O3S and a molecular weight of 477.58 g/mol. Its IUPAC name is 3-amino-2-[[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]ethylamino]methyl]prop-2-enal.
| Compound Name | 3-amino-2-[[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]ethylamino]methyl]prop-2-enal |
|---|---|
| PubChem CID | 161485850 |
| Molecular Formula | C24H29F2N3O3S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-amino-2-[[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]ethylamino]methyl]prop-2-enal |
| SMILES | CC(NCC(C=O)=CN)c1cc(F)c(CN2[C@@H](C)CC[C@H](c3ccccc3)S2(=O)=O)cc1F |
| InChI | InChI=1S/C24H29F2N3O3S/c1-16-8-9-24(19-6-4-3-5-7-19)33(31,32)29(16)14-20-10-23(26)21(11-22(20)25)17(2)28-13-18(12-27)15-30/h3-7,10-12,15-17,24,28H,8-9,13-14,27H2,1-2H3/t16-,17?,24+/m0/s1 |
| InChIKey | RUIOJOMHYXXRIF-GMQWRUITSA-N |
| XLogP | 3.71 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|