About tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate
tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate (PubChem CID 161486166) has the molecular formula C18H20FN5O3
and a molecular weight of 373.39 g/mol. Its IUPAC name is tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate |
| PubChem CID | 161486166 |
| Molecular Formula | C18H20FN5O3 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate |
| SMILES | [C-]#[N+]c1c(NC(=O)[C@H]2C[C@@H](F)CN2)ccc2c1cnn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H20FN5O3/c1-18(2,3)27-17(26)24-14-6-5-12(15(20-4)11(14)9-22-24)23-16(25)13-7-10(19)8-21-13/h5-6,9-10,13,21H,7-8H2,1-3H3,(H,23,25)/t10-,13-/m1/s1 |
| InChIKey | SOWLGYALZPKWAL-ZWNOBZJWSA-N |
| XLogP | 3.01 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate?
The IUPAC name of tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate (CID 161486166) is tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate.
What is the SMILES notation for tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate?
The canonical SMILES for tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate is [C-]#[N+]c1c(NC(=O)[C@H]2C[C@@H](F)CN2)ccc2c1cnn2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate?
The InChIKey is SOWLGYALZPKWAL-ZWNOBZJWSA-N. The full InChI is InChI=1S/C18H20FN5O3/c1-18(2,3)27-17(26)24-14-6-5-12(15(20-4)11(14)9-22-24)23-16(25)13-7-10(19)8-21-13/h5-6,9-10,13,21H,7-8H2,1-3H3,(H,23,25)/t10-,13-/m1/s1.
What are the key properties of tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate?
tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate has a molecular weight of 373.39 g/mol, XLogP of 3.01, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-[[(2R,4R)-4-fluoropyrrolidine-2-carbonyl]amino]-4-isocyanoindazole-1-carboxylate is sourced from PubChem (CID 161486166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).