C32H29N3O5S — CID 161487344
(3R,4S,5E)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethylidene)oxolan-2-ol (PubChem CID 161487344) has the molecular formula C32H29N3O5S and a molecular weight of 567.67 g/mol. Its IUPAC name is (3R,4S,5E)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethylidene)oxolan-2-ol.
| Compound Name | (3R,4S,5E)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethylidene)oxolan-2-ol |
|---|---|
| PubChem CID | 161487344 |
| Molecular Formula | C32H29N3O5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | (3R,4S,5E)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethylidene)oxolan-2-ol |
| SMILES | Nc1ncnc2c(C3(O)O/C(=C/OCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3OCc3ccccc3)scc12 |
| InChI | InChI=1S/C32H29N3O5S/c33-31-25-20-41-30(27(25)34-21-35-31)32(36)29(39-18-24-14-8-3-9-15-24)28(38-17-23-12-6-2-7-13-23)26(40-32)19-37-16-22-10-4-1-5-11-22/h1-15,19-21,28-29,36H,16-18H2,(H2,33,34,35)/b26-19+/t28-,29-,32?/m1/s1 |
| InChIKey | WFDKIMULGNITFQ-MKSNOQAQSA-N |
| XLogP | 5.68 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|