C20H34N2O — CID 161489072
(4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol;(4E,6Z)-N-methylnona-4,6,8-trien-1-amine (PubChem CID 161489072) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is (4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol;(4E,6Z)-N-methylnona-4,6,8-trien-1-amine.
| Compound Name | (4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol;(4E,6Z)-N-methylnona-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 161489072 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (4E,6Z)-1-(methylamino)nona-4,6,8-trien-1-ol;(4E,6Z)-N-methylnona-4,6,8-trien-1-amine |
| SMILES | C=C/C=C\C=C\CCC(O)NC.C=C/C=C\C=C\CCCNC |
| InChI | InChI=1S/C10H17NO.C10H17N/c1-3-4-5-6-7-8-9-10(12)11-2;1-3-4-5-6-7-8-9-10-11-2/h3-7,10-12H,1,8-9H2,2H3;3-7,11H,1,8-10H2,2H3/b2*5-4-,7-6+ |
| InChIKey | WFJFSBOTVZQMKW-SWYKPZPSSA-N |
| XLogP | 3.89 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|