About (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one
(5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one (PubChem CID 161489230) has the molecular formula C20H26N2O
and a molecular weight of 310.44 g/mol. Its IUPAC name is (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one.
Molecular Properties
| Compound Name | (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one |
| PubChem CID | 161489230 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one |
| SMILES | CC(C)[C@@H](C)CC(=O)C(C)(C)c1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-14(2)15(3)10-19(23)20(4,5)18-8-6-16(7-9-18)17-11-21-13-22-12-17/h6-9,11-15H,10H2,1-5H3/t15-/m0/s1 |
| InChIKey | DRNFBIQXSAQJFK-HNNXBMFYSA-N |
| XLogP | 4.67 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one?
The IUPAC name of (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one (CID 161489230) is (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one.
What is the SMILES notation for (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one?
The canonical SMILES for (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one is CC(C)[C@@H](C)CC(=O)C(C)(C)c1ccc(-c2cncnc2)cc1.
What is the InChIKey of (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one?
The InChIKey is DRNFBIQXSAQJFK-HNNXBMFYSA-N. The full InChI is InChI=1S/C20H26N2O/c1-14(2)15(3)10-19(23)20(4,5)18-8-6-16(7-9-18)17-11-21-13-22-12-17/h6-9,11-15H,10H2,1-5H3/t15-/m0/s1.
What are the key properties of (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one?
(5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one has a molecular weight of 310.44 g/mol, XLogP of 4.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,5,6-trimethyl-2-(4-pyrimidin-5-ylphenyl)heptan-3-one is sourced from PubChem (CID 161489230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).