C25H34F5IO6 — CID 161490117
5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;4,4,6,6,6-pentafluorohexyl 2,2-dimethylbutanoate (PubChem CID 161490117) has the molecular formula C25H34F5IO6 and a molecular weight of 652.44 g/mol. Its IUPAC name is 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;4,4,6,6,6-pentafluorohexyl 2,2-dimethylbutanoate.
| Compound Name | 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;4,4,6,6,6-pentafluorohexyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 161490117 |
| Molecular Formula | C25H34F5IO6 |
| Molecular Weight | 652.44 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;4,4,6,6,6-pentafluorohexyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCC(F)(F)CC(F)(F)F.CCC(C)(C)C(=O)Oc1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15IO4.C12H19F5O2/c1-4-13(2,3)12(17)18-8-5-6-10(14)9(7-8)11(15)16;1-4-10(2,3)9(18)19-7-5-6-11(13,14)8-12(15,16)17/h5-7H,4H2,1-3H3,(H,15,16);4-8H2,1-3H3 |
| InChIKey | WFMLZQIFCSFGII-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.44 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|