About 4-amino-2-fluorophenol;phenol
4-amino-2-fluorophenol;phenol (PubChem CID 161491150) has the molecular formula C12H12FNO2
and a molecular weight of 221.23 g/mol. Its IUPAC name is 4-amino-2-fluorophenol;phenol.
Molecular Properties
| Compound Name | 4-amino-2-fluorophenol;phenol |
| PubChem CID | 161491150 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-amino-2-fluorophenol;phenol |
| SMILES | Nc1ccc(O)c(F)c1.Oc1ccccc1 |
| InChI | InChI=1S/C6H6FNO.C6H6O/c7-5-3-4(8)1-2-6(5)9;7-6-4-2-1-3-5-6/h1-3,9H,8H2;1-5,7H |
| InChIKey | WFPWRNHAGUNKMZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-fluorophenol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-fluorophenol;phenol?
The IUPAC name of 4-amino-2-fluorophenol;phenol (CID 161491150) is 4-amino-2-fluorophenol;phenol.
What is the SMILES notation for 4-amino-2-fluorophenol;phenol?
The canonical SMILES for 4-amino-2-fluorophenol;phenol is Nc1ccc(O)c(F)c1.Oc1ccccc1.
What is the InChIKey of 4-amino-2-fluorophenol;phenol?
The InChIKey is WFPWRNHAGUNKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO.C6H6O/c7-5-3-4(8)1-2-6(5)9;7-6-4-2-1-3-5-6/h1-3,9H,8H2;1-5,7H.
What are the key properties of 4-amino-2-fluorophenol;phenol?
4-amino-2-fluorophenol;phenol has a molecular weight of 221.23 g/mol, XLogP of 2.51, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-fluorophenol;phenol is sourced from PubChem (CID 161491150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).