About trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium
trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 161493263) has the molecular formula C11H22F3N2O4S+
and a molecular weight of 335.37 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
Molecular Properties
| Compound Name | trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| PubChem CID | 161493263 |
| Molecular Formula | C11H22F3N2O4S+ |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H20N2O.CHF3O3S/c1-9(2)10(13)11-7-6-8-12(3,4)5;2-1(3,4)8(5,6)7/h1,6-8H2,2-5H3;(H,5,6,7)/p+1 |
| InChIKey | WFWJHYHMNRRJHF-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium?
The IUPAC name of trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (CID 161493263) is trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
What is the SMILES notation for trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium?
The canonical SMILES for trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium is C=C(C)C(=O)NCCC[N+](C)(C)C.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium?
The InChIKey is WFWJHYHMNRRJHF-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H20N2O.CHF3O3S/c1-9(2)10(13)11-7-6-8-12(3,4)5;2-1(3,4)8(5,6)7/h1,6-8H2,2-5H3;(H,5,6,7)/p+1.
What are the key properties of trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium?
trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium has a molecular weight of 335.37 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonic acid;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium is sourced from PubChem (CID 161493263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).