C29H25FN8O2 — CID 161493745
2-[3-[4-amino-6-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoro-3,4-dihydroisoquinolin-1-one (PubChem CID 161493745) has the molecular formula C29H25FN8O2 and a molecular weight of 536.57 g/mol. Its IUPAC name is 2-[3-[4-amino-6-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoro-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[3-[4-amino-6-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoro-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 161493745 |
| Molecular Formula | C29H25FN8O2 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2-[3-[4-amino-6-(pyrazolo[1,5-a]pyrimidin-3-ylmethyl)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoro-3,4-dihydroisoquinolin-1-one |
| SMILES | Nc1nc(Cc2cnn3cccnc23)nc(-c2cccc(N3CCc4cc(C5CC5)cc(F)c4C3=O)c2CO)n1 |
| InChI | InChI=1S/C29H25FN8O2/c30-22-12-18(16-5-6-16)11-17-7-10-37(28(40)25(17)22)23-4-1-3-20(21(23)15-39)26-34-24(35-29(31)36-26)13-19-14-33-38-9-2-8-32-27(19)38/h1-4,8-9,11-12,14,16,39H,5-7,10,13,15H2,(H2,31,34,35,36) |
| InChIKey | WFXXZXJZJSOCRH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |