C24H34BO3P2+ — CID 161493875
CID 161493875 (PubChem CID 161493875) has the molecular formula C24H34BO3P2+ and a molecular weight of 443.29 g/mol.
| Compound Name | CID 161493875 |
|---|---|
| PubChem CID | 161493875 |
| Molecular Formula | C24H34BO3P2+ |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | — |
| SMILES | O=[P@]1(c2ccccc2)CCCC1CCO.[B][P+]1(c2ccccc2)CCCC1CCO |
| InChI | InChI=1S/C12H17BOP.C12H17O2P/c13-15(11-5-2-1-3-6-11)10-4-7-12(15)8-9-14;13-9-8-12-7-4-10-15(12,14)11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2;1-3,5-6,12-13H,4,7-10H2/q+1;/t;12?,15-/m.0/s1 |
| InChIKey | GFYTWKSPXZOJTK-QORGDKPFSA-N |
| XLogP | 4.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|