C23H28Cl2N4O3 — CID 161494190
N-[1-(3,4-dichlorophenyl)-3-hydroxypropyl]-2-[[(1R,3S)-3-hydroxycyclopentyl]methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide (PubChem CID 161494190) has the molecular formula C23H28Cl2N4O3 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)-3-hydroxypropyl]-2-[[(1R,3S)-3-hydroxycyclopentyl]methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)-3-hydroxypropyl]-2-[[(1R,3S)-3-hydroxycyclopentyl]methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 161494190 |
| Molecular Formula | C23H28Cl2N4O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)-3-hydroxypropyl]-2-[[(1R,3S)-3-hydroxycyclopentyl]methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NC(CCO)c1ccc(Cl)c(Cl)c1)N1CCc2cnc(C[C@H]3CC[C@H](O)C3)nc2C1 |
| InChI | InChI=1S/C23H28Cl2N4O3/c24-18-4-2-15(11-19(18)25)20(6-8-30)28-23(32)29-7-5-16-12-26-22(27-21(16)13-29)10-14-1-3-17(31)9-14/h2,4,11-12,14,17,20,30-31H,1,3,5-10,13H2,(H,28,32)/t14-,17-,20?/m0/s1 |
| InChIKey | WFZHGLJERUKVGB-OJIYZUOWSA-N |
| XLogP | 3.68 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |