C16H28O6 — CID 161494785
ethyl 4-hydroxycyclohexane-1-carboxylate;4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 161494785) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is ethyl 4-hydroxycyclohexane-1-carboxylate;4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | ethyl 4-hydroxycyclohexane-1-carboxylate;4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 161494785 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | ethyl 4-hydroxycyclohexane-1-carboxylate;4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CCOC(=O)C1CCC(O)CC1.O=C(O)C1CCC(O)CC1 |
| InChI | InChI=1S/C9H16O3.C7H12O3/c1-2-12-9(11)7-3-5-8(10)6-4-7;8-6-3-1-5(2-4-6)7(9)10/h7-8,10H,2-6H2,1H3;5-6,8H,1-4H2,(H,9,10) |
| InChIKey | WGBCHQFDDHSERL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |