C32H38N2O3 — CID 161495094
(3R,4S)-1-[(1S,2R,5S,6R,14R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]pyrrolidine-3,4-diol (PubChem CID 161495094) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is (3R,4S)-1-[(1S,2R,5S,6R,14R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[(1S,2R,5S,6R,14R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 161495094 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (3R,4S)-1-[(1S,2R,5S,6R,14R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]pyrrolidine-3,4-diol |
| SMILES | C[C@]12CC=C3C=C4CC[C@@H](N5C[C@@H](O)[C@@H](O)C5)CC45CC[C@]3(O5)[C@@H]1CC[C@@H]2c1ccc2ccncc2c1 |
| InChI | InChI=1S/C32H38N2O3/c1-30-10-8-24-15-23-4-5-25(34-18-27(35)28(36)19-34)16-31(23)11-12-32(24,37-31)29(30)7-6-26(30)21-3-2-20-9-13-33-17-22(20)14-21/h2-3,8-9,13-15,17,25-29,35-36H,4-7,10-12,16,18-19H2,1H3/t25-,26-,27-,28+,29-,30-,31?,32-/m1/s1 |
| InChIKey | VLIGNVRNWBPUND-FDQYDAARSA-N |
| XLogP | 4.88 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |