About 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane
4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane (PubChem CID 161496329) has the molecular formula C20H41NO
and a molecular weight of 311.55 g/mol. Its IUPAC name is 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane.
Molecular Properties
| Compound Name | 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane |
| PubChem CID | 161496329 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane |
| SMILES | CC(C)C1CCOCC1.CN(C)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H25N.C8H16O/c1-12(2,3)10-6-8-11(9-7-10)13(4)5;1-7(2)8-3-5-9-6-4-8/h10-11H,6-9H2,1-5H3;7-8H,3-6H2,1-2H3 |
| InChIKey | WGGHJKCNPPCPLA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane?
The IUPAC name of 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane (CID 161496329) is 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane.
What is the SMILES notation for 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane?
The canonical SMILES for 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane is CC(C)C1CCOCC1.CN(C)C1CCC(C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane?
The InChIKey is WGGHJKCNPPCPLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N.C8H16O/c1-12(2,3)10-6-8-11(9-7-10)13(4)5;1-7(2)8-3-5-9-6-4-8/h10-11H,6-9H2,1-5H3;7-8H,3-6H2,1-2H3.
What are the key properties of 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane?
4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane has a molecular weight of 311.55 g/mol, XLogP of 5.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N,N-dimethylcyclohexan-1-amine;4-propan-2-yloxane is sourced from PubChem (CID 161496329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).