About 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane
2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane (PubChem CID 161498038) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane.
Molecular Properties
| Compound Name | 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane |
| PubChem CID | 161498038 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane |
| SMILES | CC(C)(C)OCC1CO1.CCCCOCC1CO1 |
| InChI | InChI=1S/2C7H14O2/c1-7(2,3)9-5-6-4-8-6;1-2-3-4-8-5-7-6-9-7/h6H,4-5H2,1-3H3;7H,2-6H2,1H3 |
| InChIKey | WGLXFEUNDYDCBX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane?
The IUPAC name of 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane (CID 161498038) is 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane.
What is the SMILES notation for 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane?
The canonical SMILES for 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane is CC(C)(C)OCC1CO1.CCCCOCC1CO1.
What is the InChIKey of 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane?
The InChIKey is WGLXFEUNDYDCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O2/c1-7(2,3)9-5-6-4-8-6;1-2-3-4-8-5-7-6-9-7/h6H,4-5H2,1-3H3;7H,2-6H2,1H3.
What are the key properties of 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane?
2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane has a molecular weight of 260.37 g/mol, XLogP of 2.40, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butoxymethyl)oxirane;2-[(2-methylpropan-2-yl)oxymethyl]oxirane is sourced from PubChem (CID 161498038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).