C22H42N2O — CID 161498385
ethane;3,4,5,6,7-penta(propan-2-yl)-1H-1,3-diazepin-2-one (PubChem CID 161498385) has the molecular formula C22H42N2O and a molecular weight of 350.59 g/mol. Its IUPAC name is ethane;3,4,5,6,7-penta(propan-2-yl)-1H-1,3-diazepin-2-one.
| Compound Name | ethane;3,4,5,6,7-penta(propan-2-yl)-1H-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 161498385 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | ethane;3,4,5,6,7-penta(propan-2-yl)-1H-1,3-diazepin-2-one |
| SMILES | CC.CC(C)C1=C(C(C)C)C(C(C)C)=C(C(C)C)N(C(C)C)C(=O)N1 |
| InChI | InChI=1S/C20H36N2O.C2H6/c1-11(2)16-17(12(3)4)19(14(7)8)22(15(9)10)20(23)21-18(16)13(5)6;1-2/h11-15H,1-10H3,(H,21,23);1-2H3 |
| InChIKey | WGNBBMJABRGRMZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |