About (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride
(4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride (PubChem CID 161498688) has the molecular formula C17H21ClN2O6
and a molecular weight of 384.82 g/mol. Its IUPAC name is (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride.
Molecular Properties
| Compound Name | (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride |
| PubChem CID | 161498688 |
| Molecular Formula | C17H21ClN2O6 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride |
| SMILES | O=C(Cl)N1CCOCC1.O=Cc1ccc(OC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C12H13NO4.C5H8ClNO2/c14-9-10-1-3-11(4-2-10)17-12(15)13-5-7-16-8-6-13;6-5(8)7-1-3-9-4-2-7/h1-4,9H,5-8H2;1-4H2 |
| InChIKey | WGOBATSIFWSQEB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride?
The IUPAC name of (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride (CID 161498688) is (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride.
What is the SMILES notation for (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride?
The canonical SMILES for (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride is O=C(Cl)N1CCOCC1.O=Cc1ccc(OC(=O)N2CCOCC2)cc1.
What is the InChIKey of (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride?
The InChIKey is WGOBATSIFWSQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4.C5H8ClNO2/c14-9-10-1-3-11(4-2-10)17-12(15)13-5-7-16-8-6-13;6-5(8)7-1-3-9-4-2-7/h1-4,9H,5-8H2;1-4H2.
What are the key properties of (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride?
(4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride has a molecular weight of 384.82 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl) morpholine-4-carboxylate;morpholine-4-carbonyl chloride is sourced from PubChem (CID 161498688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).