About 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium
2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium (PubChem CID 161498734) has the molecular formula C9H19N2Zr-
and a molecular weight of 246.49 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium.
Molecular Properties
| Compound Name | 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium |
| PubChem CID | 161498734 |
| Molecular Formula | C9H19N2Zr- |
| Molecular Weight | 246.49 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium |
| SMILES | CN1CCN=C1C(C)(C)C.[CH3-].[Zr] |
| InChI | InChI=1S/C8H16N2.CH3.Zr/c1-8(2,3)7-9-5-6-10(7)4;;/h5-6H2,1-4H3;1H3;/q;-1; |
| InChIKey | VZFWKSHTRXRYMP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium?
The IUPAC name of 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium (CID 161498734) is 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium.
What is the SMILES notation for 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium?
The canonical SMILES for 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium is CN1CCN=C1C(C)(C)C.[CH3-].[Zr].
What is the InChIKey of 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium?
The InChIKey is VZFWKSHTRXRYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.CH3.Zr/c1-8(2,3)7-9-5-6-10(7)4;;/h5-6H2,1-4H3;1H3;/q;-1;.
What are the key properties of 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium?
2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium has a molecular weight of 246.49 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-methyl-4,5-dihydroimidazole;carbanide;zirconium is sourced from PubChem (CID 161498734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).