C44H60N4O5S — CID 161499731
methyl 2,2-dimethyl-5-oxo-5-[pentan-3-yl-[[3-[[3-[[4-(3-piperidin-1-ylpropyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl]methyl]amino]pentanoate (PubChem CID 161499731) has the molecular formula C44H60N4O5S and a molecular weight of 757.05 g/mol. Its IUPAC name is methyl 2,2-dimethyl-5-oxo-5-[pentan-3-yl-[[3-[[3-[[4-(3-piperidin-1-ylpropyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl]methyl]amino]pentanoate.
| Compound Name | methyl 2,2-dimethyl-5-oxo-5-[pentan-3-yl-[[3-[[3-[[4-(3-piperidin-1-ylpropyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl]methyl]amino]pentanoate |
|---|---|
| PubChem CID | 161499731 |
| Molecular Formula | C44H60N4O5S |
| Molecular Weight | 757.05 g/mol |
| Exact Mass | 756.43 |
| IUPAC Name | methyl 2,2-dimethyl-5-oxo-5-[pentan-3-yl-[[3-[[3-[[4-(3-piperidin-1-ylpropyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl]methyl]amino]pentanoate |
| SMILES | CCC(CC)N(Cc1cccc(C(=O)Nc2sc3c(c2C(=O)Nc2ccc(CCCN4CCCCC4)cc2)CCCC3)c1)C(=O)CCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C44H60N4O5S/c1-6-35(7-2)48(38(49)24-25-44(3,4)43(52)53-5)30-32-15-13-17-33(29-32)40(50)46-42-39(36-18-9-10-19-37(36)54-42)41(51)45-34-22-20-31(21-23-34)16-14-28-47-26-11-8-12-27-47/h13,15,17,20-23,29,35H,6-12,14,16,18-19,24-28,30H2,1-5H3,(H,45,51)(H,46,50) |
| InChIKey | WGRIWPJTPKXXHG-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.05 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |