About 2-phenylguanidine
2-phenylguanidine (PubChem CID 16157) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-phenylguanidine.
Molecular Properties
| Compound Name | 2-phenylguanidine |
| PubChem CID | 16157 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-phenylguanidine |
| SMILES | NC(N)=Nc1ccccc1 |
| InChI | InChI=1S/C7H9N3/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H4,8,9,10) |
| InChIKey | QRJZGVVKGFIGLI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylguanidine?
The IUPAC name of 2-phenylguanidine (CID 16157) is 2-phenylguanidine.
What is the SMILES notation for 2-phenylguanidine?
The canonical SMILES for 2-phenylguanidine is NC(N)=Nc1ccccc1.
What is the InChIKey of 2-phenylguanidine?
The InChIKey is QRJZGVVKGFIGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H4,8,9,10).
What are the key properties of 2-phenylguanidine?
2-phenylguanidine has a molecular weight of 135.17 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylguanidine is sourced from PubChem (CID 16157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).