C8H8N4O2 — CID 1616
5,7-diamino-2,3-dihydrophthalazine-1,4-dione (PubChem CID 1616) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 5,7-diamino-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5,7-diamino-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 1616 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 5,7-diamino-2,3-dihydrophthalazine-1,4-dione |
| SMILES | Nc1cc(N)c2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C8H8N4O2/c9-3-1-4-6(5(10)2-3)8(14)12-11-7(4)13/h1-2H,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | BAOICLZZDLLDRL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|