C24H45N3O2 — CID 16188551
4-tert-butyl-N-(3-methyl-1-oxo-1-{[3-(piperidin-1-yl)propyl]amino}butan-2-yl)cyclohexanecarboxamide (PubChem CID 16188551) has the molecular formula C24H45N3O2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-methyl-1-oxo-1-(3-piperidin-1-ylpropylamino)butan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(3-methyl-1-oxo-1-{[3-(piperidin-1-yl)propyl]amino}butan-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16188551 |
| Molecular Formula | C24H45N3O2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.35 |
| IUPAC Name | 4-tert-butyl-N-[3-methyl-1-oxo-1-(3-piperidin-1-ylpropylamino)butan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CC(C)C(C(=O)NCCCN1CCCCC1)NC(=O)C2CCC(CC2)C(C)(C)C |
| InChI | InChI=1S/C24H45N3O2/c1-18(2)21(23(29)25-14-9-17-27-15-7-6-8-16-27)26-22(28)19-10-12-20(13-11-19)24(3,4)5/h18-21H,6-17H2,1-5H3,(H,25,29)(H,26,28) |
| InChIKey | WDNUPQJQJLLHTM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | 513 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|