C23H33N3O2S — CID 16189063
1'-[(Phenylthio)acetyl]-4-(pyrrolidin-1-ylcarbonyl)-1,4'-bipiperidine (PubChem CID 16189063) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is 2-phenylsulfanyl-1-[4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 1'-[(Phenylthio)acetyl]-4-(pyrrolidin-1-ylcarbonyl)-1,4'-bipiperidine |
|---|---|
| PubChem CID | 16189063 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-phenylsulfanyl-1-[4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethanone |
| SMILES | C1CCN(C1)C(=O)C2CCN(CC2)C3CCN(CC3)C(=O)CSC4=CC=CC=C4 |
| InChI | InChI=1S/C23H33N3O2S/c27-22(18-29-21-6-2-1-3-7-21)25-16-10-20(11-17-25)24-14-8-19(9-15-24)23(28)26-12-4-5-13-26/h1-3,6-7,19-20H,4-5,8-18H2 |
| InChIKey | YRSLWUIPRBEYPL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | 544 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |