About 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine
1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine (PubChem CID 16195403) has the molecular formula C18H13FN4O2
and a molecular weight of 336.30 g/mol. Its IUPAC name is (3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine |
| PubChem CID | 16195403 |
| Molecular Formula | C18H13FN4O2 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-(4-fluorophenyl)methanone |
| SMILES | COC1=CC2=NC3=C(C=C2C=C1)C(=NN3C(=O)C4=CC=C(C=C4)F)N |
| InChI | InChI=1S/C18H13FN4O2/c1-25-13-7-4-11-8-14-16(20)22-23(17(14)21-15(11)9-13)18(24)10-2-5-12(19)6-3-10/h2-9H,1H3,(H2,20,22) |
| InChIKey | ZQTBEKXRSLAOOC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | 499 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine?
The IUPAC name of 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine (CID 16195403) is (3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-(4-fluorophenyl)methanone.
What is the SMILES notation for 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine?
The canonical SMILES for 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine is COC1=CC2=NC3=C(C=C2C=C1)C(=NN3C(=O)C4=CC=C(C=C4)F)N.
What is the InChIKey of 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine?
The InChIKey is ZQTBEKXRSLAOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN4O2/c1-25-13-7-4-11-8-14-16(20)22-23(17(14)21-15(11)9-13)18(24)10-2-5-12(19)6-3-10/h2-9H,1H3,(H2,20,22).
What are the key properties of 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine?
1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine has a molecular weight of 336.30 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorobenzoyl)-7-methoxy-1H-pyrazolo[3,4-b]quinolin-3-amine is sourced from PubChem (CID 16195403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).