About dioxido(oxo)phosphanium;heptane;neodymium(3+)
dioxido(oxo)phosphanium;heptane;neodymium(3+) (PubChem CID 162000198) has the molecular formula C7H15NdO3P+
and a molecular weight of 322.41 g/mol. Its IUPAC name is dioxido(oxo)phosphanium;heptane;neodymium(3+).
Molecular Properties
| Compound Name | dioxido(oxo)phosphanium;heptane;neodymium(3+) |
| PubChem CID | 162000198 |
| Molecular Formula | C7H15NdO3P+ |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | dioxido(oxo)phosphanium;heptane;neodymium(3+) |
| SMILES | O=[P+]([O-])[O-].[CH2-]CCCCCC.[Nd+3] |
| InChI | InChI=1S/C7H15.Nd.HO3P/c1-3-5-7-6-4-2;;1-4(2)3/h1,3-7H2,2H3;;(H,1,2,3)/q-1;+3;/p-1 |
| InChIKey | ZEKIYNMZBVVLPZ-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)phosphanium;heptane;neodymium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)phosphanium;heptane;neodymium(3+)?
The IUPAC name of dioxido(oxo)phosphanium;heptane;neodymium(3+) (CID 162000198) is dioxido(oxo)phosphanium;heptane;neodymium(3+).
What is the SMILES notation for dioxido(oxo)phosphanium;heptane;neodymium(3+)?
The canonical SMILES for dioxido(oxo)phosphanium;heptane;neodymium(3+) is O=[P+]([O-])[O-].[CH2-]CCCCCC.[Nd+3].
What is the InChIKey of dioxido(oxo)phosphanium;heptane;neodymium(3+)?
The InChIKey is ZEKIYNMZBVVLPZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H15.Nd.HO3P/c1-3-5-7-6-4-2;;1-4(2)3/h1,3-7H2,2H3;;(H,1,2,3)/q-1;+3;/p-1.
What are the key properties of dioxido(oxo)phosphanium;heptane;neodymium(3+)?
dioxido(oxo)phosphanium;heptane;neodymium(3+) has a molecular weight of 322.41 g/mol, XLogP of 1.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)phosphanium;heptane;neodymium(3+) is sourced from PubChem (CID 162000198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).