H4FNaO7P2 — CID 162002259
sodium;dihydrogen phosphate;fluorophosphonic acid (PubChem CID 162002259) has the molecular formula H4FNaO7P2 and a molecular weight of 219.96 g/mol. Its IUPAC name is sodium;dihydrogen phosphate;fluorophosphonic acid.
| Compound Name | sodium;dihydrogen phosphate;fluorophosphonic acid |
|---|---|
| PubChem CID | 162002259 |
| Molecular Formula | H4FNaO7P2 |
| Molecular Weight | 219.96 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | sodium;dihydrogen phosphate;fluorophosphonic acid |
| SMILES | O=P(O)(O)F.O=P([O-])(O)O.[Na+] |
| InChI | InChI=1S/FH2O3P.Na.H3O4P/c1-5(2,3)4;;1-5(2,3)4/h(H2,2,3,4);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | YSJGCAHBJNLOIZ-UHFFFAOYSA-M |
| XLogP | -4.51 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.96 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|