About 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole
1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole (PubChem CID 162005964) has the molecular formula C25H18BrN3O2
and a molecular weight of 472.34 g/mol. Its IUPAC name is 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole.
Molecular Properties
| Compound Name | 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole |
| PubChem CID | 162005964 |
| Molecular Formula | C25H18BrN3O2 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole |
| SMILES | Brc1cccc(-c2ccccc2)c1.O=[N+]([O-])c1cnccc1-c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C13H9N3O2.C12H9Br/c17-16(18)13-8-14-5-4-11(13)10-2-1-9-3-6-15-12(9)7-10;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-8,15H;1-9H |
| InChIKey | YSVMJSOQOXOLFI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole?
The IUPAC name of 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole (CID 162005964) is 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole.
What is the SMILES notation for 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole?
The canonical SMILES for 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole is Brc1cccc(-c2ccccc2)c1.O=[N+]([O-])c1cnccc1-c1ccc2cc[nH]c2c1.
What is the InChIKey of 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole?
The InChIKey is YSVMJSOQOXOLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2.C12H9Br/c17-16(18)13-8-14-5-4-11(13)10-2-1-9-3-6-15-12(9)7-10;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-8,15H;1-9H.
What are the key properties of 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole?
1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole has a molecular weight of 472.34 g/mol, XLogP of 7.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-phenylbenzene;6-(3-nitro-4-pyridinyl)-1H-indole is sourced from PubChem (CID 162005964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).