About [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid
[3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 162008667) has the molecular formula C27H24BrNO4S
and a molecular weight of 538.46 g/mol. Its IUPAC name is [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 162008667 |
| Molecular Formula | C27H24BrNO4S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(Br)cc1C(=O)O.NCc1cccc(-c2ccc(Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C18H17NS.C9H7BrO4/c19-13-15-7-4-8-16(11-15)18-10-9-17(20-18)12-14-5-2-1-3-6-14;1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h1-11H,12-13,19H2;2-3H,1H3,(H,11,12)(H,13,14) |
| InChIKey | YTEFONHYGXRJHW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid (CID 162008667) is [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid is Cc1c(C(=O)O)cc(Br)cc1C(=O)O.NCc1cccc(-c2ccc(Cc3ccccc3)s2)c1.
What is the InChIKey of [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is YTEFONHYGXRJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NS.C9H7BrO4/c19-13-15-7-4-8-16(11-15)18-10-9-17(20-18)12-14-5-2-1-3-6-14;1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h1-11H,12-13,19H2;2-3H,1H3,(H,11,12)(H,13,14).
What are the key properties of [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid?
[3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 538.46 g/mol, XLogP of 6.62, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-benzylthiophen-2-yl)phenyl]methanamine;5-bromo-2-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 162008667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).