C23H29ClN4O4S — CID 162008941
6-chloro-1,2,3,4-tetrahydroquinoline;(Z)-3-hydroxy-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylbut-2-enimidamide;molecular hydrogen (PubChem CID 162008941) has the molecular formula C23H29ClN4O4S and a molecular weight of 493.03 g/mol. Its IUPAC name is 6-chloro-1,2,3,4-tetrahydroquinoline;(Z)-3-hydroxy-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylbut-2-enimidamide;molecular hydrogen.
| Compound Name | 6-chloro-1,2,3,4-tetrahydroquinoline;(Z)-3-hydroxy-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylbut-2-enimidamide;molecular hydrogen |
|---|---|
| PubChem CID | 162008941 |
| Molecular Formula | C23H29ClN4O4S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 6-chloro-1,2,3,4-tetrahydroquinoline;(Z)-3-hydroxy-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylbut-2-enimidamide;molecular hydrogen |
| SMILES | C/C(O)=C/C(N)=NS(=O)(=O)c1ccc(N2CCCC2=O)cc1.Clc1ccc2c(c1)CCCN2.[H][H] |
| InChI | InChI=1S/C14H17N3O4S.C9H10ClN.H2/c1-10(18)9-13(15)16-22(20,21)12-6-4-11(5-7-12)17-8-2-3-14(17)19;10-8-3-4-9-7(6-8)2-1-5-11-9;/h4-7,9,18H,2-3,8H2,1H3,(H2,15,16);3-4,6,11H,1-2,5H2;1H/b10-9-;; |
| InChIKey | YTFAJUACZGCCHU-XXAVUKJNSA-N |
| XLogP | 4.27 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|