C31H43N3O5Si — CID 162009726
ethyl 5-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl]oxy-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (PubChem CID 162009726) has the molecular formula C31H43N3O5Si and a molecular weight of 565.79 g/mol. Its IUPAC name is ethyl 5-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl]oxy-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl]oxy-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 162009726 |
| Molecular Formula | C31H43N3O5Si |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | ethyl 5-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl]oxy-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ccc(OC)cc2)c1OC1CCC(c2ccc(O[Si](C)(C)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C31H43N3O5Si/c1-8-37-30(35)28-29(34(33-32-28)21-22-9-15-25(36-5)16-10-22)38-26-17-11-23(12-18-26)24-13-19-27(20-14-24)39-40(6,7)31(2,3)4/h9-10,13-16,19-20,23,26H,8,11-12,17-18,21H2,1-7H3 |
| InChIKey | RVXKCMTZNROTQA-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|