About 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene
1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene (PubChem CID 162010246) has the molecular formula C19H30
and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene.
Molecular Properties
| Compound Name | 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene |
| PubChem CID | 162010246 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene |
| SMILES | CC(C)(C)CCc1cccc(C2(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H30/c1-17(2,3)11-10-15-8-7-9-16(14-15)19(12-13-19)18(4,5)6/h7-9,14H,10-13H2,1-6H3 |
| InChIKey | ZBKQGQISGQGBMB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene?
The IUPAC name of 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene (CID 162010246) is 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene.
What is the SMILES notation for 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene?
The canonical SMILES for 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene is CC(C)(C)CCc1cccc(C2(C(C)(C)C)CC2)c1.
What is the InChIKey of 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene?
The InChIKey is ZBKQGQISGQGBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30/c1-17(2,3)11-10-15-8-7-9-16(14-15)19(12-13-19)18(4,5)6/h7-9,14H,10-13H2,1-6H3.
What are the key properties of 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene?
1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene has a molecular weight of 258.45 g/mol, XLogP of 5.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-tert-butylcyclopropyl)-3-(3,3-dimethylbutyl)benzene is sourced from PubChem (CID 162010246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).