C11H16FN3O3P+ — CID 162010540
[(1R,2R,3R,5S)-5-ethyl-2-fluoro-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium (PubChem CID 162010540) has the molecular formula C11H16FN3O3P+ and a molecular weight of 288.24 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-5-ethyl-2-fluoro-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(1R,2R,3R,5S)-5-ethyl-2-fluoro-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 162010540 |
| Molecular Formula | C11H16FN3O3P+ |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [(1R,2R,3R,5S)-5-ethyl-2-fluoro-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium |
| SMILES | CC[C@H]1C[C@@H](Nc2ccncn2)[C@@H](F)[C@@H]1O[P+](=O)O |
| InChI | InChI=1S/C11H15FN3O3P/c1-2-7-5-8(10(12)11(7)18-19(16)17)15-9-3-4-13-6-14-9/h3-4,6-8,10-11H,2,5H2,1H3,(H-,13,14,15,16,17)/p+1/t7-,8+,10+,11+/m0/s1 |
| InChIKey | XXUDZAGEODMKBZ-SCVMZPAESA-O |
| XLogP | 2.06 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|