About sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate
sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate (PubChem CID 162010745) has the molecular formula C10H12NNaO3S3
and a molecular weight of 313.40 g/mol. Its IUPAC name is sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate.
Molecular Properties
| Compound Name | sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate |
| PubChem CID | 162010745 |
| Molecular Formula | C10H12NNaO3S3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)[O-].S=c1[nH]c2ccccc2s1.[Na+] |
| InChI | InChI=1S/C7H5NS2.C3H8O3S.Na/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-3-7(4,5)6;/h1-4H,(H,8,9);2-3H2,1H3,(H,4,5,6);/q;;+1/p-1 |
| InChIKey | HTOCRRNUVFJVMU-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate?
The IUPAC name of sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate (CID 162010745) is sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate.
What is the SMILES notation for sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate?
The canonical SMILES for sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate is CCCS(=O)(=O)[O-].S=c1[nH]c2ccccc2s1.[Na+].
What is the InChIKey of sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate?
The InChIKey is HTOCRRNUVFJVMU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NS2.C3H8O3S.Na/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-3-7(4,5)6;/h1-4H,(H,8,9);2-3H2,1H3,(H,4,5,6);/q;;+1/p-1.
What are the key properties of sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate?
sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate has a molecular weight of 313.40 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3H-1,3-benzothiazole-2-thione;propane-1-sulfonate is sourced from PubChem (CID 162010745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).