About N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine
N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine (PubChem CID 162010819) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine.
Molecular Properties
| Compound Name | N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine |
| PubChem CID | 162010819 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine |
| SMILES | CCCC/N=C/C(C)(C)C1(C)CCC2CC1C2(C)C |
| InChI | InChI=1S/C18H33N/c1-7-8-11-19-13-16(2,3)18(6)10-9-14-12-15(18)17(14,4)5/h13-15H,7-12H2,1-6H3/b19-13+ |
| InChIKey | YTLHAWHYYYJWIB-CPNJWEJPSA-N |
| XLogP | 5.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine?
The IUPAC name of N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine (CID 162010819) is N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine.
What is the SMILES notation for N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine?
The canonical SMILES for N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine is CCCC/N=C/C(C)(C)C1(C)CCC2CC1C2(C)C.
What is the InChIKey of N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine?
The InChIKey is YTLHAWHYYYJWIB-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H33N/c1-7-8-11-19-13-16(2,3)18(6)10-9-14-12-15(18)17(14,4)5/h13-15H,7-12H2,1-6H3/b19-13+.
What are the key properties of N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine?
N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine has a molecular weight of 263.47 g/mol, XLogP of 5.35, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-methyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)propan-1-imine is sourced from PubChem (CID 162010819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).