About phosphanium N,N-dimethylmethanamine
phosphanium N,N-dimethylmethanamine (PubChem CID 162011510) has the molecular formula C3H13NP+
and a molecular weight of 94.12 g/mol. Its IUPAC name is phosphanium N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | phosphanium N,N-dimethylmethanamine |
| PubChem CID | 162011510 |
| Molecular Formula | C3H13NP+ |
| Molecular Weight | 94.12 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | phosphanium N,N-dimethylmethanamine |
| SMILES | CN(C)C.[PH4+] |
| InChI | InChI=1S/C3H9N.H3P/c1-4(2)3;/h1-3H3;1H3/p+1 |
| InChIKey | YTNSNFSZEOAYRF-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.12 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphanium N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphanium N,N-dimethylmethanamine?
The IUPAC name of phosphanium N,N-dimethylmethanamine (CID 162011510) is phosphanium N,N-dimethylmethanamine.
What is the SMILES notation for phosphanium N,N-dimethylmethanamine?
The canonical SMILES for phosphanium N,N-dimethylmethanamine is CN(C)C.[PH4+].
What is the InChIKey of phosphanium N,N-dimethylmethanamine?
The InChIKey is YTNSNFSZEOAYRF-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N.H3P/c1-4(2)3;/h1-3H3;1H3/p+1.
What are the key properties of phosphanium N,N-dimethylmethanamine?
phosphanium N,N-dimethylmethanamine has a molecular weight of 94.12 g/mol, XLogP of -0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phosphanium N,N-dimethylmethanamine is sourced from PubChem (CID 162011510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).