C11H20O2P- — CID 162013493
(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl) acetate;phosphanide (PubChem CID 162013493) has the molecular formula C11H20O2P- and a molecular weight of 215.25 g/mol. Its IUPAC name is (5,6-dimethyl-2-bicyclo[2.2.1]heptanyl) acetate;phosphanide.
| Compound Name | (5,6-dimethyl-2-bicyclo[2.2.1]heptanyl) acetate;phosphanide |
|---|---|
| PubChem CID | 162013493 |
| Molecular Formula | C11H20O2P- |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (5,6-dimethyl-2-bicyclo[2.2.1]heptanyl) acetate;phosphanide |
| SMILES | CC(=O)OC1CC2CC1C(C)C2C.[PH2-] |
| InChI | InChI=1S/C11H18O2.H2P/c1-6-7(2)10-4-9(6)5-11(10)13-8(3)12;/h6-7,9-11H,4-5H2,1-3H3;1H2/q;-1 |
| InChIKey | YTUFPTHDIBBDKJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|