C44H50N2O10S2 — CID 162013638
methyl 4-[[(3R,4R)-3-(3,4-dimethoxyphenyl)thian-4-yl]carbamoyl]benzoate (PubChem CID 162013638) has the molecular formula C44H50N2O10S2 and a molecular weight of 831.02 g/mol. Its IUPAC name is methyl 4-[[(3R,4R)-3-(3,4-dimethoxyphenyl)thian-4-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(3R,4R)-3-(3,4-dimethoxyphenyl)thian-4-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 162013638 |
| Molecular Formula | C44H50N2O10S2 |
| Molecular Weight | 831.02 g/mol |
| Exact Mass | 830.29 |
| IUPAC Name | methyl 4-[[(3R,4R)-3-(3,4-dimethoxyphenyl)thian-4-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N[C@@H]2CCSC[C@@H]2c2ccc(OC)c(OC)c2)cc1.COC(=O)c1ccc(C(=O)N[C@@H]2CCSC[C@@H]2c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/2C22H25NO5S/c2*1-26-19-9-8-16(12-20(19)27-2)17-13-29-11-10-18(17)23-21(24)14-4-6-15(7-5-14)22(25)28-3/h2*4-9,12,17-18H,10-11,13H2,1-3H3,(H,23,24)/t2*17-,18-/m11/s1 |
| InChIKey | YTUSGBFVJLETSG-SZEXEZDWSA-N |
| XLogP | 7.02 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.02 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |