C22H32BrN7O2 — CID 162014396
1-[2-amino-6-(bromomethyl)-2H-pyridin-1-yl]-2,2-dimethylpropan-1-one;N-[6-(azidomethyl)-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 162014396) has the molecular formula C22H32BrN7O2 and a molecular weight of 506.45 g/mol. Its IUPAC name is 1-[2-amino-6-(bromomethyl)-2H-pyridin-1-yl]-2,2-dimethylpropan-1-one;N-[6-(azidomethyl)-2-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | 1-[2-amino-6-(bromomethyl)-2H-pyridin-1-yl]-2,2-dimethylpropan-1-one;N-[6-(azidomethyl)-2-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 162014396 |
| Molecular Formula | C22H32BrN7O2 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-[2-amino-6-(bromomethyl)-2H-pyridin-1-yl]-2,2-dimethylpropan-1-one;N-[6-(azidomethyl)-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N1C(CBr)=CC=CC1N.CC(C)(C)C(=O)Nc1cccc(CN=[N+]=[N-])n1 |
| InChI | InChI=1S/C11H17BrN2O.C11H15N5O/c1-11(2,3)10(15)14-8(7-12)5-4-6-9(14)13;1-11(2,3)10(17)15-9-6-4-5-8(14-9)7-13-16-12/h4-6,9H,7,13H2,1-3H3;4-6H,7H2,1-3H3,(H,14,15,17) |
| InChIKey | YTXGGLOHCMJIEI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|