C17H34O2 — CID 162014497
2,6-dimethylheptan-4-one;5-methylheptan-3-one (PubChem CID 162014497) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-one;5-methylheptan-3-one.
| Compound Name | 2,6-dimethylheptan-4-one;5-methylheptan-3-one |
|---|---|
| PubChem CID | 162014497 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 2,6-dimethylheptan-4-one;5-methylheptan-3-one |
| SMILES | CC(C)CC(=O)CC(C)C.CCC(=O)CC(C)CC |
| InChI | InChI=1S/C9H18O.C8H16O/c1-7(2)5-9(10)6-8(3)4;1-4-7(3)6-8(9)5-2/h7-8H,5-6H2,1-4H3;7H,4-6H2,1-3H3 |
| InChIKey | YTXMJEXLUUZVKS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |