C25H40F3N7O2 — CID 162016975
2-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)piperazin-1-yl]butyl]-1H-1,2,4-triazine;2,2,2-trifluoroacetic acid (PubChem CID 162016975) has the molecular formula C25H40F3N7O2 and a molecular weight of 527.64 g/mol. Its IUPAC name is 2-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)piperazin-1-yl]butyl]-1H-1,2,4-triazine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)piperazin-1-yl]butyl]-1H-1,2,4-triazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162016975 |
| Molecular Formula | C25H40F3N7O2 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 2-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)piperazin-1-yl]butyl]-1H-1,2,4-triazine;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)c1cc(N2CCN(CCCCN3C=NC=CN3)CC2)nc(C(C)(C)C)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H39N7.C2HF3O2/c1-22(2,3)19-17-20(27-21(26-19)23(4,5)6)29-15-13-28(14-16-29)11-7-8-12-30-18-24-9-10-25-30;3-2(4,5)1(6)7/h9-10,17-18,25H,7-8,11-16H2,1-6H3;(H,6,7) |
| InChIKey | XADPFNQONMGIJC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|