About ethanol;methanol;trideuterio(deuteriooxy)methane
ethanol;methanol;trideuterio(deuteriooxy)methane (PubChem CID 162018504) has the molecular formula C4H14O3
and a molecular weight of 114.18 g/mol. Its IUPAC name is ethanol;methanol;trideuterio(deuteriooxy)methane.
Molecular Properties
| Compound Name | ethanol;methanol;trideuterio(deuteriooxy)methane |
| PubChem CID | 162018504 |
| Molecular Formula | C4H14O3 |
| Molecular Weight | 114.18 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | ethanol;methanol;trideuterio(deuteriooxy)methane |
| SMILES | CCO.CO.[2H]OC([2H])([2H])[2H] |
| InChI | InChI=1S/C2H6O.2CH4O/c1-2-3;2*1-2/h3H,2H2,1H3;2*2H,1H3/i;1D3,2D; |
| InChIKey | YUKYVUHULHUJSC-CNLJRFSTSA-N |
| XLogP | -0.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.18 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanol;methanol;trideuterio(deuteriooxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;methanol;trideuterio(deuteriooxy)methane?
The IUPAC name of ethanol;methanol;trideuterio(deuteriooxy)methane (CID 162018504) is ethanol;methanol;trideuterio(deuteriooxy)methane.
What is the SMILES notation for ethanol;methanol;trideuterio(deuteriooxy)methane?
The canonical SMILES for ethanol;methanol;trideuterio(deuteriooxy)methane is CCO.CO.[2H]OC([2H])([2H])[2H].
What is the InChIKey of ethanol;methanol;trideuterio(deuteriooxy)methane?
The InChIKey is YUKYVUHULHUJSC-CNLJRFSTSA-N. The full InChI is InChI=1S/C2H6O.2CH4O/c1-2-3;2*1-2/h3H,2H2,1H3;2*2H,1H3/i;1D3,2D;.
What are the key properties of ethanol;methanol;trideuterio(deuteriooxy)methane?
ethanol;methanol;trideuterio(deuteriooxy)methane has a molecular weight of 114.18 g/mol, XLogP of -0.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;methanol;trideuterio(deuteriooxy)methane is sourced from PubChem (CID 162018504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).