C21H20O5Y2-2 — CID 162020711
(2S)-2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;1-[(2R)-2,3,4,6-tetrahydrochromen-6-id-2-yl]ethanone;bis(yttrium) (PubChem CID 162020711) has the molecular formula C21H20O5Y2-2 and a molecular weight of 530.20 g/mol. Its IUPAC name is (2S)-2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;1-[(2R)-2,3,4,6-tetrahydrochromen-6-id-2-yl]ethanone;bis(yttrium).
| Compound Name | (2S)-2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;1-[(2R)-2,3,4,6-tetrahydrochromen-6-id-2-yl]ethanone;bis(yttrium) |
|---|---|
| PubChem CID | 162020711 |
| Molecular Formula | C21H20O5Y2-2 |
| Molecular Weight | 530.20 g/mol |
| Exact Mass | 529.94 |
| IUPAC Name | (2S)-2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;1-[(2R)-2,3,4,6-tetrahydrochromen-6-id-2-yl]ethanone;bis(yttrium) |
| SMILES | CC(=O)[C@H]1CCc2c[c-]ccc2O1.O=C(O)[C@@H]1CCc2c[c-]ccc2O1.[Y].[Y] |
| InChI | InChI=1S/C11H11O2.C10H9O3.2Y/c1-8(12)10-7-6-9-4-2-3-5-11(9)13-10;11-10(12)9-6-5-7-3-1-2-4-8(7)13-9;;/h3-5,10H,6-7H2,1H3;2-4,9H,5-6H2,(H,11,12);;/q2*-1;;/t10-;9-;;/m10../s1 |
| InChIKey | QDPBLTOVSKBQTK-MWSJAHCTSA-N |
| XLogP | 3.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|