About 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile
1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile (PubChem CID 162022219) has the molecular formula C20H24FN3O
and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile |
| PubChem CID | 162022219 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile |
| SMILES | CN1C(=O)C2(CCCCC2)c2c(F)cc(N3CCC(C#N)CC3)cc21 |
| InChI | InChI=1S/C20H24FN3O/c1-23-17-12-15(24-9-5-14(13-22)6-10-24)11-16(21)18(17)20(19(23)25)7-3-2-4-8-20/h11-12,14H,2-10H2,1H3 |
| InChIKey | YUWWLIOTECJJAC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile?
The IUPAC name of 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile (CID 162022219) is 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile.
What is the SMILES notation for 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile?
The canonical SMILES for 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile is CN1C(=O)C2(CCCCC2)c2c(F)cc(N3CCC(C#N)CC3)cc21.
What is the InChIKey of 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile?
The InChIKey is YUWWLIOTECJJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24FN3O/c1-23-17-12-15(24-9-5-14(13-22)6-10-24)11-16(21)18(17)20(19(23)25)7-3-2-4-8-20/h11-12,14H,2-10H2,1H3.
What are the key properties of 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile?
1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile has a molecular weight of 341.43 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4'-fluoro-1'-methyl-2'-oxospiro[cyclohexane-1,3'-indole]-6'-yl)piperidine-4-carbonitrile is sourced from PubChem (CID 162022219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).