C15H22F10O6 — CID 162022585
3-[3,3-difluoro-4-[2,2,4,4-tetrafluoro-4-(1,1,3,3-tetrafluoro-4-hydroxybutoxy)butoxy]butoxy]propane-1,2-diol (PubChem CID 162022585) has the molecular formula C15H22F10O6 and a molecular weight of 488.32 g/mol. Its IUPAC name is 3-[3,3-difluoro-4-[2,2,4,4-tetrafluoro-4-(1,1,3,3-tetrafluoro-4-hydroxybutoxy)butoxy]butoxy]propane-1,2-diol.
| Compound Name | 3-[3,3-difluoro-4-[2,2,4,4-tetrafluoro-4-(1,1,3,3-tetrafluoro-4-hydroxybutoxy)butoxy]butoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 162022585 |
| Molecular Formula | C15H22F10O6 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 3-[3,3-difluoro-4-[2,2,4,4-tetrafluoro-4-(1,1,3,3-tetrafluoro-4-hydroxybutoxy)butoxy]butoxy]propane-1,2-diol |
| SMILES | OCC(O)COCCC(F)(F)COCC(F)(F)CC(F)(F)OC(F)(F)CC(F)(F)CO |
| InChI | InChI=1S/C15H22F10O6/c16-11(17,1-2-29-4-10(28)3-26)8-30-9-13(20,21)6-15(24,25)31-14(22,23)5-12(18,19)7-27/h10,26-28H,1-9H2 |
| InChIKey | YUYCUXMRCYHWNR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|