C29H41N5O2 — CID 162022660
2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-ethyl-5-isocyanoanilino)-N-(4-methylpentyl)acetamide;methane (PubChem CID 162022660) has the molecular formula C29H41N5O2 and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-ethyl-5-isocyanoanilino)-N-(4-methylpentyl)acetamide;methane.
| Compound Name | 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-ethyl-5-isocyanoanilino)-N-(4-methylpentyl)acetamide;methane |
|---|---|
| PubChem CID | 162022660 |
| Molecular Formula | C29H41N5O2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-2-ethyl-5-isocyanoanilino)-N-(4-methylpentyl)acetamide;methane |
| SMILES | C.[C-]#[N+]c1ccc(CC)c(N(CC(=O)NCCCC(C)C)CC(=O)N(C)N2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C28H37N5O2.CH4/c1-6-22-13-14-25(29-4)16-26(22)32(19-27(34)30-15-9-10-21(2)3)20-28(35)31(5)33-17-23-11-7-8-12-24(23)18-33;/h7-8,11-14,16,21H,6,9-10,15,17-20H2,1-3,5H3,(H,30,34);1H4 |
| InChIKey | YUYJNXOMTFGHPZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|