C27H42O5Si — CID 16202354
(3R,5R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-6-methyloctane-1,3-diol (PubChem CID 16202354) has the molecular formula C27H42O5Si and a molecular weight of 474.70 g/mol. Its IUPAC name is (3R,5R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-6-methyloctane-1,3-diol.
| Compound Name | (3R,5R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-6-methyloctane-1,3-diol |
|---|---|
| PubChem CID | 16202354 |
| Molecular Formula | C27H42O5Si |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (3R,5R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-6-methyloctane-1,3-diol |
| SMILES | C[C@@H](CCO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C(C)(C)C)[C@@H](C[C@@H](CCO)O)OCOC |
| InChI | InChI=1S/C27H42O5Si/c1-22(26(31-21-30-5)20-23(29)16-18-28)17-19-32-33(27(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,22-23,26,28-29H,16-21H2,1-5H3/t22-,23+,26+/m0/s1 |
| InChIKey | LWAHTWLGXFHXCP-PPJWLVRDSA-N |
| XLogP | — |
| TPSA | 68.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | 493 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|