N,N-dimethylformamide;silicic acid

C3H11NO5Si — CID 162024384

IUPACN,N-dimethylformamide;silicic acid
SMILESCN(C)C=O.O[Si](O)(O)O
InChIInChI=1S/C3H7NO.H4O4Si/c1-4(2)3-5;1-5(2,3)4/h3H,1-2H3;1-4H
InChIKeyYVEFDVURVLIJTL-UHFFFAOYSA-N
MW169.21 g/mol
LogP-2.90
Rot. Bonds1

About N,N-dimethylformamide;silicic acid

N,N-dimethylformamide;silicic acid (PubChem CID 162024384) has the molecular formula C3H11NO5Si and a molecular weight of 169.21 g/mol. Its IUPAC name is N,N-dimethylformamide;silicic acid.

Molecular Properties

Compound NameN,N-dimethylformamide;silicic acid
PubChem CID162024384
Molecular FormulaC3H11NO5Si
Molecular Weight169.21 g/mol
Exact Mass169.04
IUPAC NameN,N-dimethylformamide;silicic acid
SMILESCN(C)C=O.O[Si](O)(O)O
InChIInChI=1S/C3H7NO.H4O4Si/c1-4(2)3-5;1-5(2,3)4/h3H,1-2H3;1-4H
InChIKeyYVEFDVURVLIJTL-UHFFFAOYSA-N
XLogP-2.90
TPSA101.23 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.21
LogP ≤ 5-2.90
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze N,N-dimethylformamide;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylformamide;silicic acid?
The IUPAC name of N,N-dimethylformamide;silicic acid (CID 162024384) is N,N-dimethylformamide;silicic acid.
What is the SMILES notation for N,N-dimethylformamide;silicic acid?
The canonical SMILES for N,N-dimethylformamide;silicic acid is CN(C)C=O.O[Si](O)(O)O.
What is the InChIKey of N,N-dimethylformamide;silicic acid?
The InChIKey is YVEFDVURVLIJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.H4O4Si/c1-4(2)3-5;1-5(2,3)4/h3H,1-2H3;1-4H.
What are the key properties of N,N-dimethylformamide;silicic acid?
N,N-dimethylformamide;silicic acid has a molecular weight of 169.21 g/mol, XLogP of -2.90, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;silicic acid is sourced from PubChem (CID 162024384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).