C32H26N8O3S4 — CID 162027362
1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-(thiophen-2-ylmethylamino)-1,3-thiazol-4-ol;2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one (PubChem CID 162027362) has the molecular formula C32H26N8O3S4 and a molecular weight of 698.88 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-(thiophen-2-ylmethylamino)-1,3-thiazol-4-ol;2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one.
| Compound Name | 1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-(thiophen-2-ylmethylamino)-1,3-thiazol-4-ol;2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162027362 |
| Molecular Formula | C32H26N8O3S4 |
| Molecular Weight | 698.88 g/mol |
| Exact Mass | 698.10 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-(thiophen-2-ylmethylamino)-1,3-thiazol-4-ol;2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\Cc2cccs2)N1.O=Cc1c[nH]c2ncccc12.Oc1nc(NCc2cccs2)sc1C=C1C=Nc2ncccc21 |
| InChI | InChI=1S/C16H12N4OS2.C8H8N2OS2.C8H6N2O/c21-15-13(7-10-8-18-14-12(10)4-1-5-17-14)23-16(20-15)19-9-11-3-2-6-22-11;11-7-5-13-8(10-7)9-4-6-2-1-3-12-6;11-5-6-4-10-8-7(6)2-1-3-9-8/h1-8,21H,9H2,(H,19,20);1-3H,4-5H2,(H,9,10,11);1-5H,(H,9,10) |
| InChIKey | YDPMBEDGWDJVQR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.88 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|