C24H26N4O4S2 — CID 162028325
bis(1-[2-(methylsulfanylmethyl)phenyl]imidazole);oxalic acid (PubChem CID 162028325) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is bis(1-[2-(methylsulfanylmethyl)phenyl]imidazole);oxalic acid.
| Compound Name | bis(1-[2-(methylsulfanylmethyl)phenyl]imidazole);oxalic acid |
|---|---|
| PubChem CID | 162028325 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | bis(1-[2-(methylsulfanylmethyl)phenyl]imidazole);oxalic acid |
| SMILES | CSCc1ccccc1-n1ccnc1.CSCc1ccccc1-n1ccnc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C11H12N2S.C2H2O4/c2*1-14-8-10-4-2-3-5-11(10)13-7-6-12-9-13;3-1(4)2(5)6/h2*2-7,9H,8H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YVRKBGIHDPNCPP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|