About 2-tert-butyl-1,2-benzoxazol-2-ium;ethane
2-tert-butyl-1,2-benzoxazol-2-ium;ethane (PubChem CID 162029004) has the molecular formula C13H20NO+
and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-tert-butyl-1,2-benzoxazol-2-ium;ethane.
Molecular Properties
| Compound Name | 2-tert-butyl-1,2-benzoxazol-2-ium;ethane |
| PubChem CID | 162029004 |
| Molecular Formula | C13H20NO+ |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-tert-butyl-1,2-benzoxazol-2-ium;ethane |
| SMILES | CC.CC(C)(C)[n+]1cc2ccccc2o1 |
| InChI | InChI=1S/C11H14NO.C2H6/c1-11(2,3)12-8-9-6-4-5-7-10(9)13-12;1-2/h4-8H,1-3H3;1-2H3/q+1; |
| InChIKey | FCNPXRXGMKZTCG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1,2-benzoxazol-2-ium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,2-benzoxazol-2-ium;ethane?
The IUPAC name of 2-tert-butyl-1,2-benzoxazol-2-ium;ethane (CID 162029004) is 2-tert-butyl-1,2-benzoxazol-2-ium;ethane.
What is the SMILES notation for 2-tert-butyl-1,2-benzoxazol-2-ium;ethane?
The canonical SMILES for 2-tert-butyl-1,2-benzoxazol-2-ium;ethane is CC.CC(C)(C)[n+]1cc2ccccc2o1.
What is the InChIKey of 2-tert-butyl-1,2-benzoxazol-2-ium;ethane?
The InChIKey is FCNPXRXGMKZTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO.C2H6/c1-11(2,3)12-8-9-6-4-5-7-10(9)13-12;1-2/h4-8H,1-3H3;1-2H3/q+1;.
What are the key properties of 2-tert-butyl-1,2-benzoxazol-2-ium;ethane?
2-tert-butyl-1,2-benzoxazol-2-ium;ethane has a molecular weight of 206.31 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,2-benzoxazol-2-ium;ethane is sourced from PubChem (CID 162029004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).